Chemindex > 329-79-3
NL ▼
329-79-3 4-Fluoroacetophenone oxime |
|
| Naam product | 4-Fluoroacetophenone oxime |
| Engelse naam | 4-Fluoroacetophenone oxime;Acetophenone, 4'-fluoro-, oxime;4'-Fluoroacetophenone oxime;BRN 2086063;NSC 154663;Ethanone, 1-(4-fluorophenyl)-, oxime (9CI);1-(4-fluorophenyl)-N-hydroxyethanimine;(1E)-1-(4-fluorophenyl)ethanone oxime;(1Z)-1-(4-fluorophenyl)ethanone oxime |
| MF | C8H8FNO |
| Molecuulgewicht | 153.1536 |
| InChI | InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
| CAS-nummer | 329-79-3 |
| Moleculaire Structuur |  |
| Dichtheid | 1.12g/cm3 |
| Smeltpunt | 72℃ |
| Kookpunt | 239.8°C at 760 mmHg |
| Brekingsindex | 1.503 |
| Vlampunt | 98.8°C |
| Dampdruk | 0.0214mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 329-79-3 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 