ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride |
|
Naam product | 5-Fluoro-2-methylphenylhydrazine hydrochloride |
Engelse naam | 5-Fluoro-2-methylphenylhydrazine hydrochloride;(5-fluoro-2-methylphenyl)diazanium chloride;(5-fluoro-2-methylphenyl)hydrazine;3-Fluoro-6-methylphenylhydrazine HCl;5-Fluoro-2-methylphenylhydrazine HCl |
MF | C7H9FN2 |
Molecuulgewicht | 140.1582 |
InChI | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
CAS-nummer | 325-50-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.202g/cm3 |
Kookpunt | 212°C at 760 mmHg |
Brekingsindex | 1.594 |
Vlampunt | 82°C |
Dampdruk | 0.177mmHg at 25°C |
Risico-codes | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |