ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile |
|
Naam product | 4-(Trifluoromethylsulfonyl)benzonitrile |
Engelse naam | 4-(Trifluoromethylsulfonyl)benzonitrile;4-Cyanophenyl trifluoromethyl sulphone;4-(Trifluoromethylsulphonyl)benzonitrile;4-(Trifluoromethanesulfonyl)benzonitrile |
MF | C6H4FNO |
Molecuulgewicht | 125.1005 |
InChI | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
CAS-nummer | 312-21-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.269g/cm3 |
Smeltpunt | 84-88℃ |
Kookpunt | 166.5°C at 760 mmHg |
Brekingsindex | 1.543 |
Vlampunt | 54.5°C |
Dampdruk | 1.78mmHg at 25°C |
Risico-codes | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |