ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-38-2 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
|
Naam product | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
Engelse naam | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid;2-(2,5-dimethylthiazol-4-yl)acetic acid;(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
MF | C7H9NO2S |
Molecuulgewicht | 171.2169 |
InChI | InChI=1/C7H9NO2S/c1-4-6(3-7(9)10)8-5(2)11-4/h3H2,1-2H3,(H,9,10) |
CAS-nummer | 306937-38-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.295g/cm3 |
Smeltpunt | 98℃ |
Kookpunt | 320.5°C at 760 mmHg |
Brekingsindex | 1.572 |
Vlampunt | 147.7°C |
Dampdruk | 0.000131mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |