ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306936-76-5 2-[(5-nitro-1,3-thiazool-2-yl)thio]aniline |
|
Naam product | 2-[(5-nitro-1,3-thiazool-2-yl)thio]aniline |
Synoniemen | 2-[(5-nitro-1,3-thiazool-2-yl)sulfanyl]aniline; |
Engelse naam | 2-[(5-nitro-1,3-thiazol-2-yl)thio]aniline;2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]aniline |
MF | C9H7N3O2S2 |
Molecuulgewicht | 253.3008 |
InChI | InChI=1/C9H7N3O2S2/c10-6-3-1-2-4-7(6)15-9-11-5-8(16-9)12(13)14/h1-5H,10H2 |
CAS-nummer | 306936-76-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.55g/cm3 |
Smeltpunt | 125℃ |
Kookpunt | 466.8°C at 760 mmHg |
Brekingsindex | 1.732 |
Vlampunt | 236.1°C |
Dampdruk | 6.86E-09mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |