ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-90-0 2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetamide |
|
Naam product | 2-[4-(4-nitrofenyl)-1,3-thiazool-2-yl]acetamide |
Engelse naam | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetamide; |
MF | C11H9N3O3S |
Molecuulgewicht | 263.2725 |
InChI | InChI=1/C11H9N3O3S/c12-10(15)5-11-13-9(6-18-11)7-1-3-8(4-2-7)14(16)17/h1-4,6H,5H2,(H2,12,15) |
CAS-nummer | 306935-90-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.439g/cm3 |
Smeltpunt | 202℃ |
Kookpunt | 524.9°C at 760 mmHg |
Brekingsindex | 1.653 |
Vlampunt | 271.3°C |
Dampdruk | 4.11E-11mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |