ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-06-8 2-broom-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanon |
|
Naam product | 2-broom-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanon |
Synoniemen | 2-broom-1-(5-pyridine-2-ylthiofen-2-yl)ethanon; |
Engelse naam | 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone;2-bromo-1-(5-pyridin-2-ylthiophen-2-yl)ethanone |
MF | C11H8BrNOS |
Molecuulgewicht | 282.1563 |
InChI | InChI=1/C11H8BrNOS/c12-7-9(14)11-5-4-10(15-11)8-3-1-2-6-13-8/h1-6H,7H2 |
CAS-nummer | 306935-06-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.549g/cm3 |
Smeltpunt | 122℃ |
Kookpunt | 421.7°C at 760 mmHg |
Brekingsindex | 1.633 |
Vlampunt | 208.8°C |
Dampdruk | 2.55E-07mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |