ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Azabenzimidazole |
|
Naam product | 5-Azabenzimidazole |
Engelse naam | 5-Azabenzimidazole;1H-Imidazo[4,5-c]pyridine;3H-imidazo[4,5-c]pyridine |
MF | C6H5N3 |
Molecuulgewicht | 119.124 |
InChI | InChI=1/C6H5N3/c1-2-7-3-6-5(1)8-4-9-6/h1-4H,(H,8,9) |
CAS-nummer | 272-97-9;170245-15-5 |
Moleculaire Structuur | |
Dichtheid | 1.348g/cm3 |
Kookpunt | 425.1°C at 760 mmHg |
Brekingsindex | 1.715 |
Vlampunt | 224.4°C |
Dampdruk | 4.85E-07mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |