ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
271-58-9 2,1-Benzisoxazole |
|
Naam product | 2,1-Benzisoxazole |
Engelse naam | 2,1-Benzisoxazole; |
MF | C7H5NO |
Molecuulgewicht | 119.1207 |
InChI | InChI=1/C7H5NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5H |
CAS-nummer | 271-58-9 |
EINECS | 205-980-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.196g/cm3 |
Kookpunt | 215°C at 760 mmHg |
Brekingsindex | 1.609 |
Vlampunt | 93.9°C |
Dampdruk | 0.221mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |