ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2670-38-4 3,4-Dichlorobenzamide |
|
Naam product | 3,4-Dichlorobenzamide |
Engelse naam | 3,4-Dichlorobenzamide; |
MF | C7H5Cl2NO |
Molecuulgewicht | 190.0267 |
InChI | InChI=1/C7H5Cl2NO/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H2,10,11) |
CAS-nummer | 2670-38-4 |
Moleculaire Structuur | |
Dichtheid | 1.439g/cm3 |
Smeltpunt | 140℃ |
Kookpunt | 281.2°C at 760 mmHg |
Brekingsindex | 1.596 |
Vlampunt | 123.9°C |
Dampdruk | 0.00361mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |