ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2631-77-8 3,5-diiodosalicylaldehyde |
|
Naam product | 3,5-diiodosalicylaldehyde |
Engelse naam | 3,5-diiodosalicylaldehyde;3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde;2-hydroxy-3,5-diiodobenzaldehyde |
MF | C7H4I2O2 |
Molecuulgewicht | 373.9144 |
InChI | InChI=1/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H |
CAS-nummer | 2631-77-8 |
EINECS | 220-117-2 |
Moleculaire Structuur | |
Dichtheid | 2.602g/cm3 |
Smeltpunt | 109-110℃ |
Kookpunt | 304.6°C at 760 mmHg |
Brekingsindex | 1.787 |
Vlampunt | 138°C |
Dampdruk | 0.000481mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |