Chemindex > 230-27-3
NL ▼
230-27-3 7,8-Benzoquinoline |
|
| Naam product | 7,8-Benzoquinoline |
| Engelse naam | 7,8-Benzoquinoline;alpha-Naphthoquinoline;4-Azaphenanthrene;Benzo[h]quinoline;7,8-Benzoquinoline~alpha-Naphthoquinoline;benzo(h)quinoline;alpha-Benzoquinoline;α-naphthoquinoline |
| MF | C13H9N |
| Molecuulgewicht | 179.22 |
| InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS-nummer | 230-27-3 |
| EINECS | 205-937-0 |
| Moleculaire Structuur |  |
| Smeltpunt | 48-50℃ |
| Kookpunt | 338℃ (719 mmHg) |
| Vlampunt | 113℃ |
| Gevaarsymbolen |  Xi##Irritant:; |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S22||S24/25:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Bezoek ChemNet Mall om te informeren naar de prijs van
7,8-Benzoquinoline 230-27-3
Chemical CAS Database Service wordt geleverd door ChemIndex.com 