ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18166-64-8 p-Chlorocinnamamide |
|
Naam product | p-Chlorocinnamamide |
Engelse naam | p-Chlorocinnamamide;4-Chlorocinnamamide;(2E)-3-(4-chlorophenyl)prop-2-enamide |
MF | C9H8ClNO |
Molecuulgewicht | 181.6189 |
InChI | InChI=1/C9H8ClNO/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H2,11,12)/b6-3+ |
CAS-nummer | 18166-64-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.268g/cm3 |
Kookpunt | 390.2°C at 760 mmHg |
Brekingsindex | 1.624 |
Vlampunt | 189.8°C |
Dampdruk | 2.7E-06mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |