ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1194-21-4 2-Amino-6-chloro-4-pyrimidinol |
|
Naam product | 2-Amino-6-chloro-4-pyrimidinol |
Engelse naam | 2-Amino-6-chloro-4-pyrimidinol;2-Amino-6-chloro-4-pyrimidinol hydrate;2-Amino-4-chloro-6-hydroxypyrimidine;2-amino-6-chloropyrimidin-4(3H)-one;2-amino-6-chloropyrimidin-4-ol hydrate;2-Amino-6-chloro-4-pyrimidinol monohydrate |
MF | C4H4ClN3O |
Molecuulgewicht | 145.5471 |
InChI | InChI=1/C4H4ClN3O/c5-2-1-3(9)8-4(6)7-2/h1H2,(H2,6,8,9) |
CAS-nummer | 1194-21-4 |
EINECS | 214-785-4 |
Moleculaire Structuur | |
Dichtheid | 1.79g/cm3 |
Smeltpunt | 252℃ |
Kookpunt | 270.6°C at 760 mmHg |
Brekingsindex | 1.717 |
Vlampunt | 117.5°C |
Dampdruk | 0.00676mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |