ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114-33-0 N-Methylnicotinamide |
|
Naam product | N-Methylnicotinamide |
Engelse naam | N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
MF | C7H8N2O |
Molecuulgewicht | 136.1512 |
InChI | InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
CAS-nummer | 114-33-0 |
EINECS | 204-046-4 |
Moleculaire Structuur | |
Dichtheid | 1.106g/cm3 |
Smeltpunt | 100-105℃ |
Kookpunt | 347.7°C at 760 mmHg |
Brekingsindex | 1.529 |
Vlampunt | 164.1°C |
Dampdruk | 5.3E-05mmHg at 25°C |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |