114-33-0 N-Methylnicotinamide |
Naam product |
N-Methylnicotinamide |
Engelse naam |
N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
MF |
C7H8N2O |
Molecuulgewicht |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
CAS-nummer |
114-33-0 |
EINECS |
204-046-4 |
Moleculaire Structuur |
|
Dichtheid |
1.106g/cm3 |
Smeltpunt |
100-105℃ |
Kookpunt |
347.7°C at 760 mmHg |
Brekingsindex |
1.529 |
Vlampunt |
164.1°C |
Dampdruk |
5.3E-05mmHg at 25°C |
Gevaarsymbolen |
Xi##Irritant:;
|
Risico-codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
Veiligheid Omschrijving |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |