Chemindex > 112-61-8
NL ▼
Methyl stearate |
|
| Naam product | Methyl stearate |
| Engelse naam | Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
| MF | C19H38O2 |
| Molecuulgewicht | 298.5038 |
| InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| CAS-nummer | 112-61-8 |
| EINECS | 203-990-4 |
| Moleculaire Structuur |  |
| Dichtheid | 0.863g/cm3 |
| Smeltpunt | 37-39℃ |
| Kookpunt | 355.5°C at 760 mmHg |
| Brekingsindex | 1.444 |
| Vlampunt | 169.3°C |
| Dampdruk | 3.11E-05mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 