ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromolauric acid |
|
Naam product | 2-Bromolauric acid |
Engelse naam | 2-Bromolauric acid;2-Bromododecanoic acid |
MF | C12H23BrO2 |
Molecuulgewicht | 279.2138 |
InChI | InChI=1/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15) |
CAS-nummer | 111-56-8 |
EINECS | 203-882-7 |
Moleculaire Structuur | |
Dichtheid | 1.189g/cm3 |
Smeltpunt | 30-32℃ |
Kookpunt | 344.8°C at 760 mmHg |
Brekingsindex | 1.481 |
Vlampunt | 162.3°C |
Dampdruk | 1.15E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |