ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-21-7 Triethyleneglycoldiacetate |
|
Naam product | Triethyleneglycoldiacetate |
Engelse naam | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
MF | C10H18O6 |
Molecuulgewicht | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
CAS-nummer | 111-21-7 |
EINECS | 203-846-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.098g/cm3 |
Kookpunt | 286°C at 760 mmHg |
Brekingsindex | 1.432 |
Vlampunt | 125.2°C |
Dampdruk | 0.00271mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |