ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-42-9 Methyl caprate |
|
Naam product | Methyl caprate |
Engelse naam | Methyl caprate;Methyl decanoate;Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate;METHYLE N-CAPRINATE |
MF | C11H22O2 |
Molecuulgewicht | 186.2912 |
InChI | InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
CAS-nummer | 110-42-9 |
EINECS | 203-766-6 |
Moleculaire Structuur | |
Dichtheid | 0.872g/cm3 |
Smeltpunt | -11--14℃ |
Kookpunt | 224°C at 760 mmHg |
Brekingsindex | 1.426 |
Vlampunt | 94.4°C |
Dampdruk | 0.0934mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |