ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Succinamide |
|
Naam product | Succinamide |
Engelse naam | Succinamide;Butanediamide;Succinic diamide;Butanedioic acid diamide |
MF | C4H8N2O2 |
Molecuulgewicht | 116.1185 |
InChI | InChI=1/C4H8N2O2/c5-3(7)1-2-4(6)8/h1-2H2,(H2,5,7)(H2,6,8) |
CAS-nummer | 110-14-5 |
EINECS | 203-739-9 |
Moleculaire Structuur | |
Dichtheid | 1.207g/cm3 |
Smeltpunt | 260-265℃ |
Kookpunt | 494°C at 760 mmHg |
Brekingsindex | 1.488 |
Vlampunt | 252.6°C |
Dampdruk | 6.7E-10mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |