ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107-84-6 1-Chloro-3-methylbutane |
|
Naam product | 1-Chloro-3-methylbutane |
Engelse naam | 1-Chloro-3-methylbutane;Isoamyl chloride~Isopentyl chloride |
MF | C5H11Cl |
Molecuulgewicht | 106.5938 |
InChI | InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
CAS-nummer | 107-84-6 |
EINECS | 203-525-5 |
Moleculaire Structuur | |
Dichtheid | 0.867g/cm3 |
Kookpunt | 98.3°C at 760 mmHg |
Brekingsindex | 1.403 |
Vlampunt | 9.8°C |
Dampdruk | 46.2mmHg at 25°C |
Risico-codes | R11##Highly flammable.:; |
Veiligheid Omschrijving | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |