ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-28-5 Trans,Trans-Farnesol |
|
Naam product | Trans,Trans-Farnesol |
Engelse naam | Trans,Trans-Farnesol;trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol;3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol;(E,E)-Farnesol |
MF | C15H26O |
Molecuulgewicht | 222.3663 |
InChI | InChI=1/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
CAS-nummer | 106-28-5 |
EINECS | 225-004-1 |
Moleculaire Structuur | |
Dichtheid | 0.875g/cm3 |
Kookpunt | 283.4°C at 760 mmHg |
Brekingsindex | 1.485 |
Vlampunt | 112.5°C |
Dampdruk | 0.00037mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |