ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-08-8 1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
Naam product | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Engelse naam | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
MF | C8H16O2 |
Molecuulgewicht | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS-nummer | 105-08-8 |
EINECS | 203-268-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.004g/cm3 |
Smeltpunt | 31.5℃ |
Kookpunt | 286.2°C at 760 mmHg |
Brekingsindex | 1.47 |
Vlampunt | 161.1°C |
Oplosbaarheid in water | miscible |
Dampdruk | 0.000303mmHg at 25°C |
Risico-codes | R36:; |
Veiligheid Omschrijving | S26||S39:; |
MSDS |