ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-66-5 1,2-Diphenoxyethane |
|
Naam product | 1,2-Diphenoxyethane |
Engelse naam | 1,2-Diphenoxyethane;Ethylene glycol diphenyl ether;1,1'-[ethane-1,2-diylbis(oxy)]dibenzene;1,2-Diphenoxy ethane |
MF | C14H14O2 |
Molecuulgewicht | 214.2598 |
InChI | InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
CAS-nummer | 104-66-5 |
EINECS | 203-224-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.08g/cm3 |
Smeltpunt | 95-98℃ |
Kookpunt | 341.6°C at 760 mmHg |
Brekingsindex | 1.556 |
Vlampunt | 139.4°C |
Dampdruk | 0.000158mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |