ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-45-0 1-methoxy-4-propylbenzeen |
|
Naam product | 1-methoxy-4-propylbenzeen |
Synoniemen | 4-propylanisol = dihydroanethol = p-propylanisole; 4-n-propylanisole; |
Engelse naam | 1-Methoxy-4-propylbenzene;4-Propylanisole = Dihydroanethole = p-Propylanisole;4-n-Propylanisole |
MF | C10H14O |
Molecuulgewicht | 150.2176 |
InChI | InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 |
CAS-nummer | 104-45-0 |
EINECS | 203-203-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.922g/cm3 |
Kookpunt | 211.4°C at 760 mmHg |
Brekingsindex | 1.49 |
Vlampunt | 82.3°C |
Dampdruk | 0.266mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |