Chemindex > 103-78-6
NL ▼
103-78-6 cyclohexylacetone |
|
| Naam product | cyclohexylacetone |
| Engelse naam | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
| MF | C9H16O |
| Molecuulgewicht | 140.2227 |
| InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS-nummer | 103-78-6 |
| EINECS | 203-143-9 |
| Moleculaire Structuur |  |
| Dichtheid | 0.889g/cm3 |
| Kookpunt | 188.1°C at 760 mmHg |
| Brekingsindex | 1.441 |
| Vlampunt | 65.3°C |
| Dampdruk | 0.609mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 