ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-19-5 p-Tolyl disulfide |
|
Naam product | p-Tolyl disulfide |
Engelse naam | p-Tolyl disulfide; |
MF | C14H14S2 |
Molecuulgewicht | 246.391 |
InChI | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS-nummer | 103-19-5 |
EINECS | 203-087-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.17g/cm3 |
Smeltpunt | 43-46℃ |
Kookpunt | 349.5°C at 760 mmHg |
Brekingsindex | 1.649 |
Vlampunt | 192.6°C |
Dampdruk | 9.46E-05mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |