Chemindex > 101-99-5
NL â–¼
101-99-5 N-Phenylurethane |
|
| Naam product | N-Phenylurethane |
| Engelse naam | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| MF | C9H11NO2 |
| Molecuulgewicht | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS-nummer | 101-99-5 |
| EINECS | 202-995-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.136g/cm3 |
| Kookpunt | 238°C at 760 mmHg |
| Brekingsindex | 1.558 |
| Vlampunt | 79.2°C |
| Dampdruk | 0.0434mmHg at 25°C |
| Risico-codes | R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 