ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate |
|
Nama produk | Methyl 4-hydroxy-3-nitrobenzoate |
Nama Inggeris | Methyl 4-hydroxy-3-nitrobenzoate;4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
MF | C8H6NO5 |
Berat Molekul | 196.1375 |
InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
CAS NO | 99-42-3 |
EINECS | 202-755-3 |
Struktur Molekul | |
Titik lebur | 74-76℃ |
Titik didih | 311.1°C at 760 mmHg |
Titik nyala | 141.9°C |
Tekanan wap | 0.000315mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |