ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-29-6 2-Bromo-6-chloro-4-nitroaniline |
|
Nama produk | 2-Bromo-6-chloro-4-nitroaniline |
Nama Inggeris | 2-Bromo-6-chloro-4-nitroaniline;Benzenamine, 2-bromo-6-chloro-4-nitro-;NSC 88985;Aniline, 2-bromo-6-chloro-4-nitro-;2-Chloro-4-nitro-6-bromoaniline |
MF | C6H4BrClN2O2 |
Berat Molekul | 251.4652 |
InChI | InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
CAS NO | 99-29-6 |
EINECS | 202-745-9 |
Struktur Molekul | |
Kepadatan | 1.909g/cm3 |
Titik didih | 344.7°C at 760 mmHg |
Indeks bias | 1.677 |
Titik nyala | 162.3°C |
Tekanan wap | 6.47E-05mmHg at 25°C |
Kod Risiko | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |