ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95-26-1 2,5-Dimethylbenzothiazole |
|
Nama produk | 2,5-Dimethylbenzothiazole |
Nama Inggeris | 2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-;2,5-Dimethylbenzthiazol;2,5-Dimethylbenzthiazol [Czech];4-27-00-01101 (Beilstein Handbook Reference);BRN 0116455;2,5-dimethyl-1,3-benzothiazole |
MF | C9H9NS |
Berat Molekul | 163.2395 |
InChI | InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
CAS NO | 95-26-1 |
EINECS | 202-404-4 |
Struktur Molekul | |
Kepadatan | 1.176g/cm3 |
Titik lebur | 36-40℃ |
Titik didih | 259.4°C at 760 mmHg |
Indeks bias | 1.643 |
Titik nyala | 112.7°C |
Tekanan wap | 0.021mmHg at 25°C |
Cinta bahaya | Xn##Harmful:; |
Kod Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |