Chemindex >94-86-0
MY ▼
trans-2-ethoxy-5-(1-propenyl)phenol |
|
| Nama produk | trans-2-ethoxy-5-(1-propenyl)phenol |
| Nama Inggeris | trans-2-ethoxy-5-(1-propenyl)phenol;2-Ethoxy-5-prop-1-enylphenol;5-propenylguaethol;Vanitrope;2-ethoxy-5-(prop-1-en-1-yl)phenol;2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol;Propenyl guaethol |
| MF | C11H14O2 |
| Berat Molekul | 178.2277 |
| InChI | InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
| CAS NO | 94-86-0 |
| EINECS | 202-370-0 |
| Struktur Molekul |  |
| Kepadatan | 1.052g/cm3 |
| Titik lebur | 86-88℃ |
| Titik didih | 312.8°C at 760 mmHg |
| Indeks bias | 1.567 |
| Titik nyala | 165.2°C |
| Tekanan wap | 0.000281mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati ChemNet Mall untuk bertanya tentang harga
trans-2-ethoxy-5-(1-propenyl)phenol 94-86-0
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 