ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
927-67-3 n-Propylthiourea |
|
Nama produk | n-Propylthiourea |
Nama Inggeris | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
MF | C4H10N2S |
Berat Molekul | 118.2006 |
InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
CAS NO | 927-67-3 |
EINECS | 213-158-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.054g/cm3 |
Titik didih | 182.1°C at 760 mmHg |
Indeks bias | 1.537 |
Titik nyala | 63.9°C |
Tekanan wap | 0.825mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |