ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-2,5-diethoxy-4-nitrobenzene |
|
Nama produk | 1-Chloro-2,5-diethoxy-4-nitrobenzene |
Nama Inggeris | 1-Chloro-2,5-diethoxy-4-nitrobenzene;Benzene, 1-chloro-2,5-diethoxy-4-nitro-;2,5-Diethoxy-4-nitrochlorobenzene;5-Chloro-2-nitro-p-diethoxybenzene;NSC 60284 |
MF | C10H12ClNO4 |
Berat Molekul | 245.6596 |
InChI | InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
CAS NO | 91-43-0 |
EINECS | 202-067-3 |
Struktur Molekul | |
Kepadatan | 1.264g/cm3 |
Titik didih | 368.4°C at 760 mmHg |
Indeks bias | 1.533 |
Titik nyala | 176.6°C |
Tekanan wap | 2.7E-05mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |