ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-49-6 Isopulegyl asetat, campuran isomer |
|
Nama produk | Isopulegyl asetat, campuran isomer |
Sinonim | ;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl asetat; (1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl asetat; (1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl asetat; |
Nama Inggeris | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
MF | C12H20O2 |
Berat Molekul | 196.286 |
InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
CAS NO | 89-49-6 |
Struktur Molekul | |
Kepadatan | 0.94g/cm3 |
Titik didih | 248°C at 760 mmHg |
Indeks bias | 1.458 |
Titik nyala | 85.6°C |
Tekanan wap | 0.0248mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |