ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-05-8 7-Ethoxy-4-methylcoumarin |
|
Nama produk | 7-Ethoxy-4-methylcoumarin |
Nama Inggeris | 7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one;Ethyl 4-methylumbelliferyl ether |
MF | C12H12O3 |
Berat Molekul | 204.2219 |
InChI | InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
CAS NO | 87-05-8 |
EINECS | 201-721-5 |
Struktur Molekul | |
Kepadatan | 1.163g/cm3 |
Titik lebur | 113-114℃ |
Titik didih | 351.4°C at 760 mmHg |
Indeks bias | 1.548 |
Titik nyala | 146.2°C |
Tekanan wap | 4.12E-05mmHg at 25°C |
Keselamatan Penerangan | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |