ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-02-9 5,6-Benzoquinoline |
|
Nama produk | 5,6-Benzoquinoline |
Nama Inggeris | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
MF | C13H9N |
Berat Molekul | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
CAS NO | 85-02-9 |
EINECS | 201-582-0 |
Struktur Molekul | |
Kepadatan | 1.187g/cm3 |
Titik lebur | 89-91℃ |
Titik didih | 350.4°C at 760 mmHg |
Indeks bias | 1.726 |
Titik nyala | 155.9°C |
Tekanan wap | 8.89E-05mmHg at 25°C |
Cinta bahaya | Xn##Harmful:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |