ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-27-2 Diethyl sec-Butylmalonate |
|
Nama produk | Diethyl sec-Butylmalonate |
Nama Inggeris | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
MF | C11H20O4 |
Berat Molekul | 216.2741 |
InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
CAS NO | 83-27-2 |
EINECS | 201-463-3 |
Struktur Molekul | |
Kepadatan | 0.992g/cm3 |
Titik didih | 247.5°C at 760 mmHg |
Indeks bias | 1.431 |
Titik nyala | 103.1°C |
Tekanan wap | 0.0256mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |