ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82769-76-4 (S)-3-Amino-3-phenylpropan-1-ol |
|
Nama produk | (S)-3-Amino-3-phenylpropan-1-ol |
Nama Inggeris | (S)-3-Amino-3-phenylpropan-1-ol;(S)-1-Phenyl-3-propanolamine;(S)-3-Amino-3-phenylpropi-1-ol;(S)-3-Amino-3-phenylpropan-l-ol;(3S)-3-amino-3-phenyl-propan-1-ol hydrochloride |
MF | C9H14ClNO |
Berat Molekul | 187.6666 |
InChI | InChI=1/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H/t9-;/m0./s1 |
CAS NO | 82769-76-4 |
Struktur Molekul | |
Titik didih | 325.3°C at 760 mmHg |
Titik nyala | 150.5°C |
Tekanan wap | 9.47E-05mmHg at 25°C |
Cinta bahaya | C##Corrosive:; |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |