Chemindex >825-03-6
MY ▼
2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
|
| Nama produk | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
| Nama Inggeris | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid;2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;5-Methyl-2-norbornene-5-carboxylic Acid;(1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;(1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| MF | C9H11O2 |
| Berat Molekul | 151.183 |
| InChI | InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1 |
| CAS NO | 825-03-6 |
| Struktur Molekul | ![825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid](https://images-a.chemnet.com/suppliers/chembase/468/46854.gif "825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid") |
| Titik lebur | 83℃ |
| Titik didih | 261.352°C at 760 mmHg |
| Titik nyala | 121.096°C |
| Tekanan wap | 0.003mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 