ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Methoxyhydroquinone |
|
Nama produk | 2-Methoxyhydroquinone |
Nama Inggeris | 2-Methoxyhydroquinone;2,5-Dihydroxyanisole;2-methoxyquinol;2-methoxybenzene-1,4-diol;Methoxy hydroquinone |
MF | C7H8O3 |
Berat Molekul | 140.1366 |
InChI | InChI=1/C7H8O3/c1-10-7-4-5(8)2-3-6(7)9/h2-4,8-9H,1H3 |
CAS NO | 824-46-4 |
EINECS | 212-530-1 |
Struktur Molekul | |
Kepadatan | 1.27g/cm3 |
Titik lebur | 89-91℃ |
Titik didih | 311.3°C at 760 mmHg |
Indeks bias | 1.579 |
Titik nyala | 142.1°C |
Tekanan wap | 0.000311mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S22||S24/25:; |
MSDS |