ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-07-5 Xanthene-9-carboxylic acid |
|
Nama produk | Xanthene-9-carboxylic acid |
Nama Inggeris | Xanthene-9-carboxylic acid;xanthoic acid;Methyl xanthene-9-carboxylate;9-Xanthene carboxylic acid;Xomthene-9-carboxylic methylester acid;9H-xanthene-9-carboxylic acid;9H-xanthene-9-carboxylate |
MF | C14H9O3 |
Berat Molekul | 225.22 |
InChI | InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
CAS NO | 82-07-5 |
EINECS | 201-394-9 |
Struktur Molekul | |
Titik lebur | 221-225℃ |
Titik didih | 391.3°C at 760 mmHg |
Titik nyala | 153.1°C |
Tekanan wap | 7.99E-07mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |