ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-Terebic acid |
|
Nama produk | DL-Terebic acid |
Nama Inggeris | DL-Terebic acid;Tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid;Terebicacid;2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylic acid;Terebic acid;(3S)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate;(3R)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate |
MF | C7H9O4 |
Berat Molekul | 157.1445 |
InChI | InChI=1/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
CAS NO | 79-91-4 |
EINECS | 201-233-2 |
Struktur Molekul | |
Titik lebur | 175-180℃ |
Titik didih | 347.6°C at 760 mmHg |
Titik nyala | 148.6°C |
Tekanan wap | 9.29E-06mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |