ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-bromoacetamide |
|
Nama produk | N-bromoacetamide |
Nama Inggeris | N-bromoacetamide;N-Bromoacetamide;CCRIS 4590;Acetamide, N-bromo- |
MF | C2H4BrNO |
Berat Molekul | 137.9633 |
InChI | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
CAS NO | 79-15-2 |
EINECS | 201-181-0 |
Struktur Molekul | |
Kepadatan | 1.71g/cm3 |
Indeks bias | 1.474 |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |