ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine |
|
Nama produk | 3-(4-chlorophenyl)-1H-pyrazol-5-amine |
Nama Inggeris | 3-(4-chlorophenyl)-1H-pyrazol-5-amine;5-(4-chlorophenyl)-1H-pyrazol-3-amine |
MF | C9H8ClN3 |
Berat Molekul | 193.6329 |
InChI | InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
CAS NO | 78583-81-0 |
Struktur Molekul | |
Kepadatan | 1.378g/cm3 |
Titik lebur | 172℃ |
Titik didih | 463.8°C at 760 mmHg |
Indeks bias | 1.67 |
Titik nyala | 234.3°C |
Tekanan wap | 8.78E-09mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |