ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bromodichloromethane |
|
Nama produk | Bromodichloromethane |
Nama Inggeris | Bromodichloromethane;FC-20B1 |
MF | CHBrCl2 |
Berat Molekul | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS NO | 75-27-4 |
EINECS | 200-856-7 |
Struktur Molekul | |
Kepadatan | 2.013g/cm3 |
Titik lebur | -55℃ |
Titik didih | 89.7°C at 760 mmHg |
Indeks bias | 1.503 |
Titik nyala | 1.3°C |
Tekanan wap | 65.3mmHg at 25°C |
Cinta bahaya | Xn##Harmful:; |
Kod Risiko | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |