Chemindex >7223-38-3
MY ▼
7223-38-3 1-Dimethylamino-2-propyne |
|
| Nama produk | 1-Dimethylamino-2-propyne |
| Nama Inggeris | 1-Dimethylamino-2-propyne;N,N-Dimethyl-2-propynyl-1-amine;N,N-Dimethylpropargylamine;N,N-dimethylprop-2-yn-1-amine;N,N-dimethylprop-2-yn-1-aminium |
| MF | C5H10N |
| Berat Molekul | 84.1391 |
| InChI | InChI=1/C5H9N/c1-4-5-6(2)3/h1H,5H2,2-3H3/p+1 |
| CAS NO | 7223-38-3 |
| EINECS | 230-620-9 |
| Struktur Molekul |  |
| Titik didih | 81.7°C at 760 mmHg |
| Tekanan wap | 81mmHg at 25°C |
| Cinta bahaya |  F##Highly flammable||C##Corrosive:; |
| Kod Risiko | R11##Highly flammable.||R21/22##Harmful in contact with skin and if swallowed.||R34##Causes burns.:; |
| Keselamatan Penerangan | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 