Chemindex >703-23-1
MY ▼
2-Hydroxy-6-methoxyacetophenone |
|
| Nama produk | 2-Hydroxy-6-methoxyacetophenone |
| Nama Inggeris | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
| MF | C9H10O3 |
| Berat Molekul | 166.1739 |
| InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| CAS NO | 703-23-1 |
| EINECS | 211-872-9 |
| Struktur Molekul |  |
| Kepadatan | 1.158g/cm3 |
| Titik lebur | 58-60℃ |
| Titik didih | 259.5°C at 760 mmHg |
| Indeks bias | 1.537 |
| Titik nyala | 108.1°C |
| Tekanan wap | 0.00798mmHg at 25°C |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati ChemNet Mall untuk bertanya tentang harga
2-Hydroxy-6-methoxyacetophenone 703-23-1
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 