ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4'-Aminopropiophenone |
|
Nama produk | 4'-Aminopropiophenone |
Nama Inggeris | 4'-Aminopropiophenone;4-Aminopropiophenone;para-Aminopropiophenone;p-Aminopropiophenone |
MF | C9H11NO |
Berat Molekul | 149.1897 |
InChI | InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
CAS NO | 70-69-9 |
EINECS | 200-742-7 |
Struktur Molekul | |
Kepadatan | 1.067g/cm3 |
Titik lebur | 137-143℃ |
Titik didih | 305.8°C at 760 mmHg |
Indeks bias | 1.559 |
Titik nyala | 138.7°C |
Tekanan wap | 0.000805mmHg at 25°C |
Cinta bahaya | T##Toxic:; |
Kod Risiko | R25##Toxic if swallowed.:; |
Keselamatan Penerangan | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |