ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Benzoyl bromide |
|
Nama produk | Benzoyl bromide |
Nama Inggeris | Benzoyl bromide; |
MF | C7H5BrO |
Berat Molekul | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS NO | 618-32-6 |
EINECS | 210-544-2 |
Struktur Molekul | |
Kepadatan | 1.572g/cm3 |
Titik lebur | -24℃ |
Titik didih | 218.5°C at 760 mmHg |
Indeks bias | 1.584 |
Titik nyala | 89.7°C |
Tekanan wap | 0.125mmHg at 25°C |
Cinta bahaya | C##Corrosive:; |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |